C9H4F5NO2 — CID 154547448
N-acetyl-2,3,4,5,6-pentafluorobenzamide (PubChem CID 154547448) has the molecular formula C9H4F5NO2 and a molecular weight of 253.13 g/mol. Its IUPAC name is N-acetyl-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-acetyl-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 154547448 |
| Molecular Formula | C9H4F5NO2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | N-acetyl-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CC(=O)NC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H4F5NO2/c1-2(16)15-9(17)3-4(10)6(12)8(14)7(13)5(3)11/h1H3,(H,15,16,17) |
| InChIKey | SFRXRIJFHBUEOI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|