C8H11N3O3S — CID 154674112
CID 154674112 (PubChem CID 154674112) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol.
| Compound Name | CID 154674112 |
|---|---|
| PubChem CID | 154674112 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | — |
| SMILES | C=[S-](=O)NC(=O)c1cc[n+](CCO)nc1 |
| InChI | InChI=1S/C8H10N3O3S/c1-15(14)10-8(13)7-2-3-11(4-5-12)9-6-7/h2-3,6,12H,1,4-5H2/q-1/p+1 |
| InChIKey | KZUDGPFHLXFSQK-UHFFFAOYSA-O |
| XLogP | -1.60 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|