C18H24O4S — CID 15483070
(1S,3aR,6aS)-3a-(benzenesulfonyl)-1-pentyl-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one (PubChem CID 15483070) has the molecular formula C18H24O4S and a molecular weight of 336.45 g/mol. Its IUPAC name is (1S,3aR,6aS)-3a-(benzenesulfonyl)-1-pentyl-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one.
| Compound Name | (1S,3aR,6aS)-3a-(benzenesulfonyl)-1-pentyl-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 15483070 |
| Molecular Formula | C18H24O4S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (1S,3aR,6aS)-3a-(benzenesulfonyl)-1-pentyl-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one |
| SMILES | CCCCC[C@@H]1OC(=O)[C@@]2(S(=O)(=O)c3ccccc3)CCC[C@@H]12 |
| InChI | InChI=1S/C18H24O4S/c1-2-3-5-12-16-15-11-8-13-18(15,17(19)22-16)23(20,21)14-9-6-4-7-10-14/h4,6-7,9-10,15-16H,2-3,5,8,11-13H2,1H3/t15-,16-,18+/m0/s1 |
| InChIKey | IVFODDKHYWEFOO-XYJFISCASA-N |
| XLogP | 3.50 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|