C38H40O5 — CID 155164854
(3aR,4R,6S,6aS)-4-ethenyl-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-4-(trityloxymethyl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole (PubChem CID 155164854) has the molecular formula C38H40O5 and a molecular weight of 576.73 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-4-ethenyl-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-4-(trityloxymethyl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole.
| Compound Name | (3aR,4R,6S,6aS)-4-ethenyl-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-4-(trityloxymethyl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole |
|---|---|
| PubChem CID | 155164854 |
| Molecular Formula | C38H40O5 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | (3aR,4R,6S,6aS)-4-ethenyl-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-4-(trityloxymethyl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole |
| SMILES | C=C[C@@]1(COC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H](OCc2ccc(OC)cc2)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C38H40O5/c1-5-37(25-33(34-35(37)43-36(2,3)42-34)40-26-28-21-23-32(39-4)24-22-28)27-41-38(29-15-9-6-10-16-29,30-17-11-7-12-18-30)31-19-13-8-14-20-31/h5-24,33-35H,1,25-27H2,2-4H3/t33-,34-,35-,37-/m0/s1 |
| InChIKey | VXTXDKWWPVIPEE-SZHYKVQFSA-N |
| XLogP | 7.69 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|