C19H18BrFN8O5S — CID 155354206
benzyl N-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-nitrosooxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethylamino]sulfanylcarbamate (PubChem CID 155354206) has the molecular formula C19H18BrFN8O5S and a molecular weight of 569.37 g/mol. Its IUPAC name is benzyl N-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-nitrosooxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethylamino]sulfanylcarbamate.
| Compound Name | benzyl N-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-nitrosooxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethylamino]sulfanylcarbamate |
|---|---|
| PubChem CID | 155354206 |
| Molecular Formula | C19H18BrFN8O5S |
| Molecular Weight | 569.37 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | benzyl N-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-nitrosooxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethylamino]sulfanylcarbamate |
| SMILES | O=NON/C(=N\c1ccc(F)c(Br)c1)c1nonc1NCCNSNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18BrFN8O5S/c20-14-10-13(6-7-15(14)21)24-18(27-34-29-31)16-17(26-33-25-16)22-8-9-23-35-28-19(30)32-11-12-4-2-1-3-5-12/h1-7,10,23H,8-9,11H2,(H,22,26)(H,24,27)(H,28,30) |
| InChIKey | PPVHPKOAJYDVPD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 164.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|