C27H37FN4O3S — CID 155475478
(1R,3R)-1-[4-[2-[ethyl(3-fluoropropyl)amino]ethoxy]phenyl]-N,N,3-trimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide (PubChem CID 155475478) has the molecular formula C27H37FN4O3S and a molecular weight of 516.68 g/mol. Its IUPAC name is (1R,3R)-1-[4-[2-[ethyl(3-fluoropropyl)amino]ethoxy]phenyl]-N,N,3-trimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide.
| Compound Name | (1R,3R)-1-[4-[2-[ethyl(3-fluoropropyl)amino]ethoxy]phenyl]-N,N,3-trimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide |
|---|---|
| PubChem CID | 155475478 |
| Molecular Formula | C27H37FN4O3S |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | (1R,3R)-1-[4-[2-[ethyl(3-fluoropropyl)amino]ethoxy]phenyl]-N,N,3-trimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide |
| SMILES | CCN(CCCF)CCOc1ccc([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C27H37FN4O3S/c1-5-31(16-8-15-28)17-18-35-22-13-11-21(12-14-22)27-26-24(23-9-6-7-10-25(23)29-26)19-20(2)32(27)36(33,34)30(3)4/h6-7,9-14,20,27,29H,5,8,15-19H2,1-4H3/t20-,27-/m1/s1 |
| InChIKey | RYWHPWOHXKDHRT-NFQMXDRXSA-N |
| XLogP | 4.37 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|