C17H20N2O2 — CID 155524071
14-(2-hydroxyethyl)-1,10-diazatetracyclo[11.2.2.03,11.04,9]heptadeca-3(11),4,6,8-tetraen-12-one (PubChem CID 155524071) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 14-(2-hydroxyethyl)-1,10-diazatetracyclo[11.2.2.03,11.04,9]heptadeca-3(11),4,6,8-tetraen-12-one.
| Compound Name | 14-(2-hydroxyethyl)-1,10-diazatetracyclo[11.2.2.03,11.04,9]heptadeca-3(11),4,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 155524071 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 14-(2-hydroxyethyl)-1,10-diazatetracyclo[11.2.2.03,11.04,9]heptadeca-3(11),4,6,8-tetraen-12-one |
| SMILES | O=C1c2[nH]c3ccccc3c2CN2CCC1C(CCO)C2 |
| InChI | InChI=1S/C17H20N2O2/c20-8-6-11-9-19-7-5-12(11)17(21)16-14(10-19)13-3-1-2-4-15(13)18-16/h1-4,11-12,18,20H,5-10H2 |
| InChIKey | LAJNTYQROFEHKF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|