C17H26N2 — CID 155571479
(3Z)-N-[(2Z)-4-cyclopropyl-3-(methylideneamino)penta-2,4-dien-2-yl]-4,5-dimethylhexa-3,5-dien-1-amine (PubChem CID 155571479) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (3Z)-N-[(2Z)-4-cyclopropyl-3-(methylideneamino)penta-2,4-dien-2-yl]-4,5-dimethylhexa-3,5-dien-1-amine.
| Compound Name | (3Z)-N-[(2Z)-4-cyclopropyl-3-(methylideneamino)penta-2,4-dien-2-yl]-4,5-dimethylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 155571479 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (3Z)-N-[(2Z)-4-cyclopropyl-3-(methylideneamino)penta-2,4-dien-2-yl]-4,5-dimethylhexa-3,5-dien-1-amine |
| SMILES | C=N/C(C(=C)C1CC1)=C(/C)NCC/C=C(/C)C(=C)C |
| InChI | InChI=1S/C17H26N2/c1-12(2)13(3)8-7-11-19-15(5)17(18-6)14(4)16-9-10-16/h8,16,19H,1,4,6-7,9-11H2,2-3,5H3/b13-8-,17-15- |
| InChIKey | XEWZSVDJWPIKIU-XCVUTTPOSA-N |
| XLogP | 4.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|