C12H15F3NO4S- — CID 155621497
(1Z)-3-hydroxy-N-(trifluoromethylsulfonyl)adamantane-1-carboximidate (PubChem CID 155621497) has the molecular formula C12H15F3NO4S- and a molecular weight of 326.32 g/mol. Its IUPAC name is (1Z)-3-hydroxy-N-(trifluoromethylsulfonyl)adamantane-1-carboximidate.
| Compound Name | (1Z)-3-hydroxy-N-(trifluoromethylsulfonyl)adamantane-1-carboximidate |
|---|---|
| PubChem CID | 155621497 |
| Molecular Formula | C12H15F3NO4S- |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (1Z)-3-hydroxy-N-(trifluoromethylsulfonyl)adamantane-1-carboximidate |
| SMILES | O=S(=O)(/N=C(\[O-])C12CC3CC(CC(O)(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO4S/c13-12(14,15)21(19,20)16-9(17)10-2-7-1-8(3-10)5-11(18,4-7)6-10/h7-8,18H,1-6H2,(H,16,17)/p-1 |
| InChIKey | UDXRDKYYHVCDJE-UHFFFAOYSA-M |
| XLogP | 0.93 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|