C26H28BrNO3Si — CID 155736284
9-bromo-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 155736284) has the molecular formula C26H28BrNO3Si and a molecular weight of 510.50 g/mol. Its IUPAC name is 9-bromo-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
| Compound Name | 9-bromo-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 155736284 |
| Molecular Formula | C26H28BrNO3Si |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 9-bromo-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | CC(C)(C)[Si](OCc1cc(Br)c2c(c1)C(=O)NCCO2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28BrNO3Si/c1-26(2,3)32(20-10-6-4-7-11-20,21-12-8-5-9-13-21)31-18-19-16-22-24(23(27)17-19)30-15-14-28-25(22)29/h4-13,16-17H,14-15,18H2,1-3H3,(H,28,29) |
| InChIKey | NSYZNWTWMANBQV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|