About potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide
potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide (PubChem CID 155748464) has the molecular formula C8H13KN3-
and a molecular weight of 190.31 g/mol. Its IUPAC name is potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide.
Molecular Properties
| Compound Name | potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide |
| PubChem CID | 155748464 |
| Molecular Formula | C8H13KN3- |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide |
| SMILES | CNc1cc([NH-])cc(N)c1.[CH3-].[K+] |
| InChI | InChI=1S/C7H10N3.CH3.K/c1-10-7-3-5(8)2-6(9)4-7;;/h2-4,8,10H,9H2,1H3;1H3;/q2*-1;+1 |
| InChIKey | QZENZKOBLCUPEG-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide?
The IUPAC name of potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide (CID 155748464) is potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide.
What is the SMILES notation for potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide?
The canonical SMILES for potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide is CNc1cc([NH-])cc(N)c1.[CH3-].[K+].
What is the InChIKey of potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide?
The InChIKey is QZENZKOBLCUPEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N3.CH3.K/c1-10-7-3-5(8)2-6(9)4-7;;/h2-4,8,10H,9H2,1H3;1H3;/q2*-1;+1.
What are the key properties of potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide?
potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide has a molecular weight of 190.31 g/mol, XLogP of -0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;[3-amino-5-(methylamino)phenyl]azanide;carbanide is sourced from PubChem (CID 155748464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).