C24H36BNO7S — CID 155793066
methyl (2S,3S)-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]-6-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexanoate (PubChem CID 155793066) has the molecular formula C24H36BNO7S and a molecular weight of 493.43 g/mol. Its IUPAC name is methyl (2S,3S)-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]-6-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexanoate.
| Compound Name | methyl (2S,3S)-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]-6-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexanoate |
|---|---|
| PubChem CID | 155793066 |
| Molecular Formula | C24H36BNO7S |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | methyl (2S,3S)-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]-6-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexanoate |
| SMILES | COC(=O)[C@@H](NS(=O)(=O)c1ccc(C)cc1)[C@@H](O)CCCB1OC2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C24H36BNO7S/c1-15-8-10-17(11-9-15)34(29,30)26-21(22(28)31-5)18(27)7-6-12-25-32-20-14-16-13-19(23(16,2)3)24(20,4)33-25/h8-11,16,18-21,26-27H,6-7,12-14H2,1-5H3/t16-,18-,19-,20?,21-,24-/m0/s1 |
| InChIKey | LLONZOIUWWIIBN-ZGPRLKHZSA-N |
| XLogP | 2.68 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|