C19H26ClNOS — CID 156602644
O-[(3S)-7-propylspiro[3.5]nonan-3-yl] N-(3-chlorophenyl)carbamothioate (PubChem CID 156602644) has the molecular formula C19H26ClNOS and a molecular weight of 351.94 g/mol. Its IUPAC name is O-[(3S)-7-propylspiro[3.5]nonan-3-yl] N-(3-chlorophenyl)carbamothioate.
| Compound Name | O-[(3S)-7-propylspiro[3.5]nonan-3-yl] N-(3-chlorophenyl)carbamothioate |
|---|---|
| PubChem CID | 156602644 |
| Molecular Formula | C19H26ClNOS |
| Molecular Weight | 351.94 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | O-[(3S)-7-propylspiro[3.5]nonan-3-yl] N-(3-chlorophenyl)carbamothioate |
| SMILES | CCCC1CCC2(CC1)CC[C@@H]2OC(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H26ClNOS/c1-2-4-14-7-10-19(11-8-14)12-9-17(19)22-18(23)21-16-6-3-5-15(20)13-16/h3,5-6,13-14,17H,2,4,7-12H2,1H3,(H,21,23)/t14?,17-,19?/m0/s1 |
| InChIKey | RRJGATUIKHKVMQ-KGYZHSKHSA-N |
| XLogP | 6.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.94 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|