C25H48N2 — CID 156741347
1-N'-(5,5-diethyl-3,6-dimethylheptyl)-1-N'-ethyl-1-N-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]ethane-1,1-diamine (PubChem CID 156741347) has the molecular formula C25H48N2 and a molecular weight of 376.67 g/mol. Its IUPAC name is 1-N'-(5,5-diethyl-3,6-dimethylheptyl)-1-N'-ethyl-1-N-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]ethane-1,1-diamine.
| Compound Name | 1-N'-(5,5-diethyl-3,6-dimethylheptyl)-1-N'-ethyl-1-N-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 156741347 |
| Molecular Formula | C25H48N2 |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 376.38 |
| IUPAC Name | 1-N'-(5,5-diethyl-3,6-dimethylheptyl)-1-N'-ethyl-1-N-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]ethane-1,1-diamine |
| SMILES | C=C/C=C(C)\C=C/CNC(C)N(CC)CCC(C)CC(CC)(CC)C(C)C |
| InChI | InChI=1S/C25H48N2/c1-10-15-22(7)16-14-18-26-24(9)27(13-4)19-17-23(8)20-25(11-2,12-3)21(5)6/h10,14-16,21,23-24,26H,1,11-13,17-20H2,2-9H3/b16-14-,22-15- |
| InChIKey | SUVRQEMSLBGOFA-CLXIBKRSSA-N |
| XLogP | 6.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|