C28H28F18O3 — CID 157073104
tert-butyl 2-(trifluoromethyl)prop-2-enoate;2-ethenoxy-1,1,1-trifluoroethane;1-ethenyl-3,5-bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)benzene (PubChem CID 157073104) has the molecular formula C28H28F18O3 and a molecular weight of 754.49 g/mol. Its IUPAC name is tert-butyl 2-(trifluoromethyl)prop-2-enoate;2-ethenoxy-1,1,1-trifluoroethane;1-ethenyl-3,5-bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)benzene.
| Compound Name | tert-butyl 2-(trifluoromethyl)prop-2-enoate;2-ethenoxy-1,1,1-trifluoroethane;1-ethenyl-3,5-bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)benzene |
|---|---|
| PubChem CID | 157073104 |
| Molecular Formula | C28H28F18O3 |
| Molecular Weight | 754.49 g/mol |
| Exact Mass | 754.18 |
| IUPAC Name | tert-butyl 2-(trifluoromethyl)prop-2-enoate;2-ethenoxy-1,1,1-trifluoroethane;1-ethenyl-3,5-bis(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)benzene |
| SMILES | C=C(C(=O)OC(C)(C)C)C(F)(F)F.C=COCC(F)(F)F.C=Cc1cc(C(C)(C(F)(F)F)C(F)(F)F)cc(C(C)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12F12.C8H11F3O2.C4H5F3O/c1-4-8-5-9(11(2,13(17,18)19)14(20,21)22)7-10(6-8)12(3,15(23,24)25)16(26,27)28;1-5(8(9,10)11)6(12)13-7(2,3)4;1-2-8-3-4(5,6)7/h4-7H,1H2,2-3H3;1H2,2-4H3;2H,1,3H2 |
| InChIKey | ACQTXBDEERVVDU-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.49 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|