C41H40P2 — CID 157154593
(4R)-2-[(4R)-3,4-dimethyl-5,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-3,4-dimethyl-5,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene;methane (PubChem CID 157154593) has the molecular formula C41H40P2 and a molecular weight of 594.72 g/mol. Its IUPAC name is (4R)-2-[(4R)-3,4-dimethyl-5,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-3,4-dimethyl-5,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene;methane.
| Compound Name | (4R)-2-[(4R)-3,4-dimethyl-5,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-3,4-dimethyl-5,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene;methane |
|---|---|
| PubChem CID | 157154593 |
| Molecular Formula | C41H40P2 |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | (4R)-2-[(4R)-3,4-dimethyl-5,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-3,4-dimethyl-5,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene;methane |
| SMILES | C.CC1=C(C2=C(C)[C@@]3(C)C[P@@]2C(c2ccccc2)=C3c2ccccc2)[P@@]2C[C@@]1(C)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C40H36P2.CH4/c1-27-35(41-25-39(27,3)33(29-17-9-5-10-18-29)37(41)31-21-13-7-14-22-31)36-28(2)40(4)26-42(36)38(32-23-15-8-16-24-32)34(40)30-19-11-6-12-20-30;/h5-24H,25-26H2,1-4H3;1H4/t39-,40-,41-,42-;/m1./s1 |
| InChIKey | ALQUVDRXYWJGJD-NNVKYJRISA-N |
| XLogP | 12.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|