C30H32P2 — CID 59886641
(4S)-4,5-dimethyl-2,3-diphenyl-6-[(4R)-3,4,5,6-tetramethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene (PubChem CID 59886641) has the molecular formula C30H32P2 and a molecular weight of 454.53 g/mol. Its IUPAC name is (4S)-4,5-dimethyl-2,3-diphenyl-6-[(4R)-3,4,5,6-tetramethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | (4S)-4,5-dimethyl-2,3-diphenyl-6-[(4R)-3,4,5,6-tetramethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 59886641 |
| Molecular Formula | C30H32P2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (4S)-4,5-dimethyl-2,3-diphenyl-6-[(4R)-3,4,5,6-tetramethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC1=C(C)[C@@]2(C)C[P@@]1C(C1=C(C)[C@]3(C)C[P@]1C(c1ccccc1)=C3c1ccccc1)=C2C |
| InChI | InChI=1S/C30H32P2/c1-19-22(4)31-17-29(19,5)20(2)26(31)27-21(3)30(6)18-32(27)28(24-15-11-8-12-16-24)25(30)23-13-9-7-10-14-23/h7-16H,17-18H2,1-6H3/t29-,30+,31-,32+/m1/s1 |
| InChIKey | KNMTXZNDPYCVBC-IQLXHWPESA-N |
| XLogP | 9.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|