C42H38P2 — CID 102185960
2-[(E)-2-(4,5-dimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl)ethenyl]-4,5-dimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene (PubChem CID 102185960) has the molecular formula C42H38P2 and a molecular weight of 604.71 g/mol. Its IUPAC name is 2-[(E)-2-(4,5-dimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl)ethenyl]-4,5-dimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2-[(E)-2-(4,5-dimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl)ethenyl]-4,5-dimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 102185960 |
| Molecular Formula | C42H38P2 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 2-[(E)-2-(4,5-dimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl)ethenyl]-4,5-dimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC1=C(c2ccccc2)P2CC1(C)C(c1ccccc1)=C2/C=C/C1=C(c2ccccc2)C2(C)CP1C(c1ccccc1)=C2C |
| InChI | InChI=1S/C42H38P2/c1-29-39(33-21-13-7-14-22-33)43-27-41(29,3)37(31-17-9-5-10-18-31)35(43)25-26-36-38(32-19-11-6-12-20-32)42(4)28-44(36)40(30(42)2)34-23-15-8-16-24-34/h5-26H,27-28H2,1-4H3/b26-25+ |
| InChIKey | CUWPIVKHBKMSGT-OCEACIFDSA-N |
| XLogP | 12.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|