C20H28P2 — CID 91533932
(4S)-2,3,4,5-tetramethyl-6-[(4S)-3,4,5,6-tetramethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene (PubChem CID 91533932) has the molecular formula C20H28P2 and a molecular weight of 330.39 g/mol. Its IUPAC name is (4S)-2,3,4,5-tetramethyl-6-[(4S)-3,4,5,6-tetramethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | (4S)-2,3,4,5-tetramethyl-6-[(4S)-3,4,5,6-tetramethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 91533932 |
| Molecular Formula | C20H28P2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (4S)-2,3,4,5-tetramethyl-6-[(4S)-3,4,5,6-tetramethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC1=C(C)[C@]2(C)CP1C(C1=C(C)[C@@]3(C)CP1C(C)=C3C)=C2C |
| InChI | InChI=1S/C20H28P2/c1-11-15(5)21-9-19(11,7)13(3)17(21)18-14(4)20(8)10-22(18)16(6)12(20)2/h9-10H2,1-8H3/t19-,20-,21?,22?/m0/s1 |
| InChIKey | AKBBZRNBJGWRRZ-PHZLKFDYSA-N |
| XLogP | 7.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|