C21H21P — CID 147827670
(4R)-2,4,5-trimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene (PubChem CID 147827670) has the molecular formula C21H21P and a molecular weight of 304.37 g/mol. Its IUPAC name is (4R)-2,4,5-trimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | (4R)-2,4,5-trimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 147827670 |
| Molecular Formula | C21H21P |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (4R)-2,4,5-trimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC1=C(c2ccccc2)[C@]2(C)CP1C(c1ccccc1)=C2C |
| InChI | InChI=1S/C21H21P/c1-15-20(18-12-8-5-9-13-18)22-14-21(15,3)19(16(22)2)17-10-6-4-7-11-17/h4-13H,14H2,1-3H3/t21-,22?/m1/s1 |
| InChIKey | HQLUODIUAWEQFJ-ZMFCMNQTSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|