C20H19P — CID 173272223
4,5-dimethyl-2,3-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene (PubChem CID 173272223) has the molecular formula C20H19P and a molecular weight of 290.35 g/mol. Its IUPAC name is 4,5-dimethyl-2,3-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 4,5-dimethyl-2,3-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 173272223 |
| Molecular Formula | C20H19P |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4,5-dimethyl-2,3-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC1=C[P@]2CC1(C)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C20H19P/c1-15-13-21-14-20(15,2)18(16-9-5-3-6-10-16)19(21)17-11-7-4-8-12-17/h3-13H,14H2,1-2H3/t20?,21-/m1/s1 |
| InChIKey | LGXFWGHXYDQFLO-BPGUCPLFSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|