C24H40P2 — CID 91547889
ethane;(4S)-2,3,4,5-tetramethyl-6-[(4S)-3,4,5,6-tetramethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene (PubChem CID 91547889) has the molecular formula C24H40P2 and a molecular weight of 390.53 g/mol. Its IUPAC name is ethane;(4S)-2,3,4,5-tetramethyl-6-[(4S)-3,4,5,6-tetramethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | ethane;(4S)-2,3,4,5-tetramethyl-6-[(4S)-3,4,5,6-tetramethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 91547889 |
| Molecular Formula | C24H40P2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | ethane;(4S)-2,3,4,5-tetramethyl-6-[(4S)-3,4,5,6-tetramethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC.CC.CC1=C(C)[C@]2(C)CP1C(C1=C(C)[C@@]3(C)CP1C(C)=C3C)=C2C |
| InChI | InChI=1S/C20H28P2.2C2H6/c1-11-15(5)21-9-19(11,7)13(3)17(21)18-14(4)20(8)10-22(18)16(6)12(20)2;2*1-2/h9-10H2,1-8H3;2*1-2H3/t19-,20-,21?,22?;;/m0../s1 |
| InChIKey | YLWYGUKXSWAFEP-HZDCTHNQSA-N |
| XLogP | 9.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|