C3H4F6O4S2 — CID 15717519
(4,4-difluoro-2,2-dioxooxathietan-3-yl)-tetrafluoro-methoxy-lambda6-sulfane (PubChem CID 15717519) has the molecular formula C3H4F6O4S2 and a molecular weight of 282.18 g/mol. Its IUPAC name is (4,4-difluoro-2,2-dioxooxathietan-3-yl)-tetrafluoro-methoxy-lambda6-sulfane.
| Compound Name | (4,4-difluoro-2,2-dioxooxathietan-3-yl)-tetrafluoro-methoxy-lambda6-sulfane |
|---|---|
| PubChem CID | 15717519 |
| Molecular Formula | C3H4F6O4S2 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | (4,4-difluoro-2,2-dioxooxathietan-3-yl)-tetrafluoro-methoxy-lambda6-sulfane |
| SMILES | COS(F)(F)(F)(F)C1C(F)(F)OS1(=O)=O |
| InChI | InChI=1S/C3H4F6O4S2/c1-12-15(6,7,8,9)2-3(4,5)13-14(2,10)11/h2H,1H3 |
| InChIKey | IESRZGHKDKXNGE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|