C4H4F4O6S3 — CID 59974328
methyl 4,4,5,5-tetrafluoro-1,1,3,3-tetraoxo-1,3-dithiolane-2-sulfinate (PubChem CID 59974328) has the molecular formula C4H4F4O6S3 and a molecular weight of 320.26 g/mol. Its IUPAC name is methyl 4,4,5,5-tetrafluoro-1,1,3,3-tetraoxo-1,3-dithiolane-2-sulfinate.
| Compound Name | methyl 4,4,5,5-tetrafluoro-1,1,3,3-tetraoxo-1,3-dithiolane-2-sulfinate |
|---|---|
| PubChem CID | 59974328 |
| Molecular Formula | C4H4F4O6S3 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.91 |
| IUPAC Name | methyl 4,4,5,5-tetrafluoro-1,1,3,3-tetraoxo-1,3-dithiolane-2-sulfinate |
| SMILES | COS(=O)C1S(=O)(=O)C(F)(F)C(F)(F)S1(=O)=O |
| InChI | InChI=1S/C4H4F4O6S3/c1-14-15(9)2-16(10,11)3(5,6)4(7,8)17(2,12)13/h2H,1H3 |
| InChIKey | ZIPMENGQXXRGMB-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|