C28H53N3O11 — CID 157251319
N-[2-(2,3-dihydroxypropoxy)ethyl]-2-methylprop-2-enamide;N-[2-[3-(1-ethoxyethoxy)-2-hydroxypropoxy]ethyl]-2-methylprop-2-enamide;N-(2-hydroxyethyl)-2-methylprop-2-enamide (PubChem CID 157251319) has the molecular formula C28H53N3O11 and a molecular weight of 607.74 g/mol. Its IUPAC name is N-[2-(2,3-dihydroxypropoxy)ethyl]-2-methylprop-2-enamide;N-[2-[3-(1-ethoxyethoxy)-2-hydroxypropoxy]ethyl]-2-methylprop-2-enamide;N-(2-hydroxyethyl)-2-methylprop-2-enamide.
| Compound Name | N-[2-(2,3-dihydroxypropoxy)ethyl]-2-methylprop-2-enamide;N-[2-[3-(1-ethoxyethoxy)-2-hydroxypropoxy]ethyl]-2-methylprop-2-enamide;N-(2-hydroxyethyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 157251319 |
| Molecular Formula | C28H53N3O11 |
| Molecular Weight | 607.74 g/mol |
| Exact Mass | 607.37 |
| IUPAC Name | N-[2-(2,3-dihydroxypropoxy)ethyl]-2-methylprop-2-enamide;N-[2-[3-(1-ethoxyethoxy)-2-hydroxypropoxy]ethyl]-2-methylprop-2-enamide;N-(2-hydroxyethyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCO.C=C(C)C(=O)NCCOCC(O)CO.C=C(C)C(=O)NCCOCC(O)COC(C)OCC |
| InChI | InChI=1S/C13H25NO5.C9H17NO4.C6H11NO2/c1-5-18-11(4)19-9-12(15)8-17-7-6-14-13(16)10(2)3;1-7(2)9(13)10-3-4-14-6-8(12)5-11;1-5(2)6(9)7-3-4-8/h11-12,15H,2,5-9H2,1,3-4H3,(H,14,16);8,11-12H,1,3-6H2,2H3,(H,10,13);8H,1,3-4H2,2H3,(H,7,9) |
| InChIKey | AWJLTHPTZVNGHP-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 205.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.74 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|