C24H31F6O3PS — CID 158013276
bis(4-tert-butylphenyl)phosphanium;1,1,2,2,3,3-hexafluorobutane-1-sulfonate (PubChem CID 158013276) has the molecular formula C24H31F6O3PS and a molecular weight of 544.54 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)phosphanium;1,1,2,2,3,3-hexafluorobutane-1-sulfonate.
| Compound Name | bis(4-tert-butylphenyl)phosphanium;1,1,2,2,3,3-hexafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 158013276 |
| Molecular Formula | C24H31F6O3PS |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | bis(4-tert-butylphenyl)phosphanium;1,1,2,2,3,3-hexafluorobutane-1-sulfonate |
| SMILES | CC(C)(C)c1ccc([PH2+]c2ccc(C(C)(C)C)cc2)cc1.CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C20H27P.C4H4F6O3S/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;1-2(5,6)3(7,8)4(9,10)14(11,12)13/h7-14,21H,1-6H3;1H3,(H,11,12,13) |
| InChIKey | FFDSEWYEOUMXGX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|