C19H34NO10P — CID 15816818
O-[[3,4-bis(2-methoxyethoxymethoxy)phenyl]-diethoxyphosphorylmethyl]hydroxylamine (PubChem CID 15816818) has the molecular formula C19H34NO10P and a molecular weight of 467.45 g/mol. Its IUPAC name is O-[[3,4-bis(2-methoxyethoxymethoxy)phenyl]-diethoxyphosphorylmethyl]hydroxylamine.
| Compound Name | O-[[3,4-bis(2-methoxyethoxymethoxy)phenyl]-diethoxyphosphorylmethyl]hydroxylamine |
|---|---|
| PubChem CID | 15816818 |
| Molecular Formula | C19H34NO10P |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | O-[[3,4-bis(2-methoxyethoxymethoxy)phenyl]-diethoxyphosphorylmethyl]hydroxylamine |
| SMILES | CCOP(=O)(OCC)C(ON)c1ccc(OCOCCOC)c(OCOCCOC)c1 |
| InChI | InChI=1S/C19H34NO10P/c1-5-28-31(21,29-6-2)19(30-20)16-7-8-17(26-14-24-11-9-22-3)18(13-16)27-15-25-12-10-23-4/h7-8,13,19H,5-6,9-12,14-15,20H2,1-4H3 |
| InChIKey | IDMOQJUMDOGGBD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 126.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|