C29H31N5O3S — CID 158470134
4-[3-[2-(1,3-benzothiazol-2-ylamino)-4-(diethylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-2-tert-butyl-5-methylpyrazol-3-one (PubChem CID 158470134) has the molecular formula C29H31N5O3S and a molecular weight of 529.67 g/mol. Its IUPAC name is 4-[3-[2-(1,3-benzothiazol-2-ylamino)-4-(diethylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-2-tert-butyl-5-methylpyrazol-3-one.
| Compound Name | 4-[3-[2-(1,3-benzothiazol-2-ylamino)-4-(diethylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-2-tert-butyl-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 158470134 |
| Molecular Formula | C29H31N5O3S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 4-[3-[2-(1,3-benzothiazol-2-ylamino)-4-(diethylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-2-tert-butyl-5-methylpyrazol-3-one |
| SMILES | CCN(CC)c1ccc(C2=C(O)C(=C3C(=O)N(C(C)(C)C)N=C3C)C2=O)c(Nc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C29H31N5O3S/c1-7-33(8-2)17-13-14-18(20(15-17)31-28-30-19-11-9-10-12-21(19)38-28)23-25(35)24(26(23)36)22-16(3)32-34(27(22)37)29(4,5)6/h9-15,35H,7-8H2,1-6H3,(H,30,31) |
| InChIKey | IIHRDDLEMRAPCF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|