C26H42O9 — CID 158612937
(Z)-hept-4-enoic acid;2-hydroxyethyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl (Z)-hept-4-enoate (PubChem CID 158612937) has the molecular formula C26H42O9 and a molecular weight of 498.61 g/mol. Its IUPAC name is (Z)-hept-4-enoic acid;2-hydroxyethyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl (Z)-hept-4-enoate.
| Compound Name | (Z)-hept-4-enoic acid;2-hydroxyethyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl (Z)-hept-4-enoate |
|---|---|
| PubChem CID | 158612937 |
| Molecular Formula | C26H42O9 |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | (Z)-hept-4-enoic acid;2-hydroxyethyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl (Z)-hept-4-enoate |
| SMILES | C=C(C)C(=O)OCCO.C=C(C)C(=O)OCCOC(=O)CC/C=C\CC.CC/C=C\CCC(=O)O |
| InChI | InChI=1S/C13H20O4.C7H12O2.C6H10O3/c1-4-5-6-7-8-12(14)16-9-10-17-13(15)11(2)3;1-2-3-4-5-6-7(8)9;1-5(2)6(8)9-4-3-7/h5-6H,2,4,7-10H2,1,3H3;3-4H,2,5-6H2,1H3,(H,8,9);7H,1,3-4H2,2H3/b6-5-;4-3-; |
| InChIKey | HXBBYCUCASHWSG-ZURCFGMXSA-N |
| XLogP | 4.31 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|