About butanoate;(2,4,6-triphenylphenyl)sulfanium
butanoate;(2,4,6-triphenylphenyl)sulfanium (PubChem CID 158828025) has the molecular formula C28H26O2S
and a molecular weight of 426.58 g/mol. Its IUPAC name is butanoate;(2,4,6-triphenylphenyl)sulfanium.
Molecular Properties
| Compound Name | butanoate;(2,4,6-triphenylphenyl)sulfanium |
| PubChem CID | 158828025 |
| Molecular Formula | C28H26O2S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | butanoate;(2,4,6-triphenylphenyl)sulfanium |
| SMILES | CCCC(=O)[O-].[SH2+]c1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C24H18S.C4H8O2/c25-24-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(24)20-14-8-3-9-15-20;1-2-3-4(5)6/h1-17,25H;2-3H2,1H3,(H,5,6) |
| InChIKey | IWRNQIVXMGMDPK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze butanoate;(2,4,6-triphenylphenyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoate;(2,4,6-triphenylphenyl)sulfanium?
The IUPAC name of butanoate;(2,4,6-triphenylphenyl)sulfanium (CID 158828025) is butanoate;(2,4,6-triphenylphenyl)sulfanium.
What is the SMILES notation for butanoate;(2,4,6-triphenylphenyl)sulfanium?
The canonical SMILES for butanoate;(2,4,6-triphenylphenyl)sulfanium is CCCC(=O)[O-].[SH2+]c1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.
What is the InChIKey of butanoate;(2,4,6-triphenylphenyl)sulfanium?
The InChIKey is IWRNQIVXMGMDPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18S.C4H8O2/c25-24-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(24)20-14-8-3-9-15-20;1-2-3-4(5)6/h1-17,25H;2-3H2,1H3,(H,5,6).
What are the key properties of butanoate;(2,4,6-triphenylphenyl)sulfanium?
butanoate;(2,4,6-triphenylphenyl)sulfanium has a molecular weight of 426.58 g/mol, XLogP of 5.59, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoate;(2,4,6-triphenylphenyl)sulfanium is sourced from PubChem (CID 158828025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).