C21H37NO4 — CID 158917743
N-[2-[3-(2,6-dimethyl-5-oxohept-6-enoxy)-2-methylbutoxy]propyl]-2-methylprop-2-enamide (PubChem CID 158917743) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is N-[2-[3-(2,6-dimethyl-5-oxohept-6-enoxy)-2-methylbutoxy]propyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-[3-(2,6-dimethyl-5-oxohept-6-enoxy)-2-methylbutoxy]propyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 158917743 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | N-[2-[3-(2,6-dimethyl-5-oxohept-6-enoxy)-2-methylbutoxy]propyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)CCC(C)COC(C)C(C)COC(C)CNC(=O)C(=C)C |
| InChI | InChI=1S/C21H37NO4/c1-14(2)20(23)10-9-16(5)12-26-19(8)17(6)13-25-18(7)11-22-21(24)15(3)4/h16-19H,1,3,9-13H2,2,4-8H3,(H,22,24) |
| InChIKey | ZQNOVJFGMWMRSQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|