C36H23EuF9N2O6S3 — CID 158941542
europium;1,10-phenanthroline;tris(4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-en-1-one) (PubChem CID 158941542) has the molecular formula C36H23EuF9N2O6S3 and a molecular weight of 998.73 g/mol. Its IUPAC name is europium;1,10-phenanthroline;tris(4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-en-1-one).
| Compound Name | europium;1,10-phenanthroline;tris(4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-en-1-one) |
|---|---|
| PubChem CID | 158941542 |
| Molecular Formula | C36H23EuF9N2O6S3 |
| Molecular Weight | 998.73 g/mol |
| Exact Mass | 998.98 |
| IUPAC Name | europium;1,10-phenanthroline;tris(4,4,4-trifluoro-3-hydroxy-1-thiophen-2-ylbut-2-en-1-one) |
| SMILES | O=C(C=C(O)C(F)(F)F)c1cccs1.O=C(C=C(O)C(F)(F)F)c1cccs1.O=C(C=C(O)C(F)(F)F)c1cccs1.[Eu].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.3C8H5F3O2S.Eu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;3*9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h1-8H;3*1-4,13H; |
| InChIKey | TZMUIUOWVAGEIF-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 998.73 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|