C12H22NO12- — CID 159140074
6-aminohexane-1,2,3,4,5-pentol;2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate (PubChem CID 159140074) has the molecular formula C12H22NO12- and a molecular weight of 372.30 g/mol. Its IUPAC name is 6-aminohexane-1,2,3,4,5-pentol;2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate.
| Compound Name | 6-aminohexane-1,2,3,4,5-pentol;2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 159140074 |
| Molecular Formula | C12H22NO12- |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 6-aminohexane-1,2,3,4,5-pentol;2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate |
| SMILES | NCC(O)C(O)C(O)C(O)CO.O=C(O)CC(O)(CC(=O)O)C(=O)[O-] |
| InChI | InChI=1S/C6H15NO5.C6H8O7/c7-1-3(9)5(11)6(12)4(10)2-8;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-6,8-12H,1-2,7H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/p-1 |
| InChIKey | KHZIAEJEPMRGDL-UHFFFAOYSA-M |
| XLogP | -6.20 |
| TPSA | 262.13 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | -6.20 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |