C14H18O4Si — CID 159151344
6-tert-butyl-3-hydroxysilylnaphthalene-1,2,4-triol (PubChem CID 159151344) has the molecular formula C14H18O4Si and a molecular weight of 278.38 g/mol. Its IUPAC name is 6-tert-butyl-3-hydroxysilylnaphthalene-1,2,4-triol.
| Compound Name | 6-tert-butyl-3-hydroxysilylnaphthalene-1,2,4-triol |
|---|---|
| PubChem CID | 159151344 |
| Molecular Formula | C14H18O4Si |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 6-tert-butyl-3-hydroxysilylnaphthalene-1,2,4-triol |
| SMILES | CC(C)(C)c1ccc2c(O)c(O)c([SiH2]O)c(O)c2c1 |
| InChI | InChI=1S/C14H18O4Si/c1-14(2,3)7-4-5-8-9(6-7)11(16)13(19-18)12(17)10(8)15/h4-6,15-18H,19H2,1-3H3 |
| InChIKey | QTFSFSMQLACGLS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|