C32H28N6S — CID 159301160
5,6-diphenyl-2H-1,2,4-triazine-3-thione;methane;3-methylidene-5,6-diphenyl-2H-1,2,4-triazine (PubChem CID 159301160) has the molecular formula C32H28N6S and a molecular weight of 528.69 g/mol. Its IUPAC name is 5,6-diphenyl-2H-1,2,4-triazine-3-thione;methane;3-methylidene-5,6-diphenyl-2H-1,2,4-triazine.
| Compound Name | 5,6-diphenyl-2H-1,2,4-triazine-3-thione;methane;3-methylidene-5,6-diphenyl-2H-1,2,4-triazine |
|---|---|
| PubChem CID | 159301160 |
| Molecular Formula | C32H28N6S |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 5,6-diphenyl-2H-1,2,4-triazine-3-thione;methane;3-methylidene-5,6-diphenyl-2H-1,2,4-triazine |
| SMILES | C.C=C1N=C(c2ccccc2)C(c2ccccc2)=NN1.S=c1nc(-c2ccccc2)c(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C16H13N3.C15H11N3S.CH4/c1-12-17-15(13-8-4-2-5-9-13)16(19-18-12)14-10-6-3-7-11-14;19-15-16-13(11-7-3-1-4-8-11)14(17-18-15)12-9-5-2-6-10-12;/h2-11,18H,1H2;1-10H,(H,16,18,19);1H4 |
| InChIKey | LBIWIFRCTCFBFS-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|