C42H51N3O8S — CID 159654050
1-[3-[[2-(2-hydroxyethoxy)ethylamino]methyl]-2,4,6-trimethylanilino]-4-[3-[3-(2-hydroxyethoxy)propylsulfonyl]-2,4,6-trimethylanilino]anthracene-9,10-dione (PubChem CID 159654050) has the molecular formula C42H51N3O8S and a molecular weight of 757.95 g/mol. Its IUPAC name is 1-[3-[[2-(2-hydroxyethoxy)ethylamino]methyl]-2,4,6-trimethylanilino]-4-[3-[3-(2-hydroxyethoxy)propylsulfonyl]-2,4,6-trimethylanilino]anthracene-9,10-dione.
| Compound Name | 1-[3-[[2-(2-hydroxyethoxy)ethylamino]methyl]-2,4,6-trimethylanilino]-4-[3-[3-(2-hydroxyethoxy)propylsulfonyl]-2,4,6-trimethylanilino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 159654050 |
| Molecular Formula | C42H51N3O8S |
| Molecular Weight | 757.95 g/mol |
| Exact Mass | 757.34 |
| IUPAC Name | 1-[3-[[2-(2-hydroxyethoxy)ethylamino]methyl]-2,4,6-trimethylanilino]-4-[3-[3-(2-hydroxyethoxy)propylsulfonyl]-2,4,6-trimethylanilino]anthracene-9,10-dione |
| SMILES | Cc1cc(C)c(Nc2ccc(Nc3c(C)cc(C)c(S(=O)(=O)CCCOCCO)c3C)c3c2C(=O)c2ccccc2C3=O)c(C)c1CNCCOCCO |
| InChI | InChI=1S/C42H51N3O8S/c1-25-22-26(2)38(29(5)33(25)24-43-14-18-53-20-16-47)44-34-12-13-35(37-36(34)40(48)31-10-7-8-11-32(31)41(37)49)45-39-27(3)23-28(4)42(30(39)6)54(50,51)21-9-17-52-19-15-46/h7-8,10-13,22-23,43-47H,9,14-21,24H2,1-6H3 |
| InChIKey | MRYIBIVFDVLYCW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.95 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|