About bromo(trifluoro)methane;naphthalene
bromo(trifluoro)methane;naphthalene (PubChem CID 159657697) has the molecular formula C11H8BrF3
and a molecular weight of 277.08 g/mol. Its IUPAC name is bromo(trifluoro)methane;naphthalene.
Molecular Properties
| Compound Name | bromo(trifluoro)methane;naphthalene |
| PubChem CID | 159657697 |
| Molecular Formula | C11H8BrF3 |
| Molecular Weight | 277.08 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | bromo(trifluoro)methane;naphthalene |
| SMILES | FC(F)(F)Br.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.CBrF3/c1-2-6-10-8-4-3-7-9(10)5-1;2-1(3,4)5/h1-8H; |
| InChIKey | MSJRCHRPQLEGOF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.08 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromo(trifluoro)methane;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo(trifluoro)methane;naphthalene?
The IUPAC name of bromo(trifluoro)methane;naphthalene (CID 159657697) is bromo(trifluoro)methane;naphthalene.
What is the SMILES notation for bromo(trifluoro)methane;naphthalene?
The canonical SMILES for bromo(trifluoro)methane;naphthalene is FC(F)(F)Br.c1ccc2ccccc2c1.
What is the InChIKey of bromo(trifluoro)methane;naphthalene?
The InChIKey is MSJRCHRPQLEGOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.CBrF3/c1-2-6-10-8-4-3-7-9(10)5-1;2-1(3,4)5/h1-8H;.
What are the key properties of bromo(trifluoro)methane;naphthalene?
bromo(trifluoro)methane;naphthalene has a molecular weight of 277.08 g/mol, XLogP of 4.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromo(trifluoro)methane;naphthalene is sourced from PubChem (CID 159657697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).