C37H50N4O8Si2 — CID 159683340
methyl 1-[4-oxo-1-(2-trimethylsilylethoxymethyl)cinnolin-3-yl]cyclopropane-1-carboxylate;methyl 2-[4-oxo-1-(2-trimethylsilylethoxymethyl)cinnolin-3-yl]prop-2-enoate (PubChem CID 159683340) has the molecular formula C37H50N4O8Si2 and a molecular weight of 735.00 g/mol. Its IUPAC name is methyl 1-[4-oxo-1-(2-trimethylsilylethoxymethyl)cinnolin-3-yl]cyclopropane-1-carboxylate;methyl 2-[4-oxo-1-(2-trimethylsilylethoxymethyl)cinnolin-3-yl]prop-2-enoate.
| Compound Name | methyl 1-[4-oxo-1-(2-trimethylsilylethoxymethyl)cinnolin-3-yl]cyclopropane-1-carboxylate;methyl 2-[4-oxo-1-(2-trimethylsilylethoxymethyl)cinnolin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 159683340 |
| Molecular Formula | C37H50N4O8Si2 |
| Molecular Weight | 735.00 g/mol |
| Exact Mass | 734.32 |
| IUPAC Name | methyl 1-[4-oxo-1-(2-trimethylsilylethoxymethyl)cinnolin-3-yl]cyclopropane-1-carboxylate;methyl 2-[4-oxo-1-(2-trimethylsilylethoxymethyl)cinnolin-3-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)c1nn(COCC[Si](C)(C)C)c2ccccc2c1=O.COC(=O)C1(c2nn(COCC[Si](C)(C)C)c3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C19H26N2O4Si.C18H24N2O4Si/c1-24-18(23)19(9-10-19)17-16(22)14-7-5-6-8-15(14)21(20-17)13-25-11-12-26(2,3)4;1-13(18(22)23-2)16-17(21)14-8-6-7-9-15(14)20(19-16)12-24-10-11-25(3,4)5/h5-8H,9-13H2,1-4H3;6-9H,1,10-12H2,2-5H3 |
| InChIKey | MVLZTSBYMVPHLD-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 140.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.00 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|