About N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate
N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate (PubChem CID 160528402) has the molecular formula C10H25NO5S2
and a molecular weight of 303.45 g/mol. Its IUPAC name is N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate.
Molecular Properties
| Compound Name | N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate |
| PubChem CID | 160528402 |
| Molecular Formula | C10H25NO5S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate |
| SMILES | CCN(C(C)C)C(C)C.CS(=O)(=O)OS(C)(=O)=O |
| InChI | InChI=1S/C8H19N.C2H6O5S2/c1-6-9(7(2)3)8(4)5;1-8(3,4)7-9(2,5)6/h7-8H,6H2,1-5H3;1-2H3 |
| InChIKey | QVFBLLNGRCGLRG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate?
The IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate (CID 160528402) is N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate.
What is the SMILES notation for N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate?
The canonical SMILES for N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate is CCN(C(C)C)C(C)C.CS(=O)(=O)OS(C)(=O)=O.
What is the InChIKey of N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate?
The InChIKey is QVFBLLNGRCGLRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C2H6O5S2/c1-6-9(7(2)3)8(4)5;1-8(3,4)7-9(2,5)6/h7-8H,6H2,1-5H3;1-2H3.
What are the key properties of N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate?
N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate has a molecular weight of 303.45 g/mol, XLogP of 1.05, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propan-2-ylpropan-2-amine;methylsulfonyl methanesulfonate is sourced from PubChem (CID 160528402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).