C11H18N4O5S — CID 160684279
N-(aminomethyl)-3-[3-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)sulfanylpropanoylamino]propanamide (PubChem CID 160684279) has the molecular formula C11H18N4O5S and a molecular weight of 318.36 g/mol. Its IUPAC name is N-(aminomethyl)-3-[3-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)sulfanylpropanoylamino]propanamide.
| Compound Name | N-(aminomethyl)-3-[3-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)sulfanylpropanoylamino]propanamide |
|---|---|
| PubChem CID | 160684279 |
| Molecular Formula | C11H18N4O5S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-(aminomethyl)-3-[3-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)sulfanylpropanoylamino]propanamide |
| SMILES | NCNC(=O)CCNC(=O)CCSC1CC(=O)N(O)C1=O |
| InChI | InChI=1S/C11H18N4O5S/c12-6-14-8(16)1-3-13-9(17)2-4-21-7-5-10(18)15(20)11(7)19/h7,20H,1-6,12H2,(H,13,17)(H,14,16) |
| InChIKey | RONZNCWJLBWIFR-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|