C37H32N2O6S — CID 160797681
4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]aniline;N-[4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]phenyl]-1-phenylmethanesulfonamide (PubChem CID 160797681) has the molecular formula C37H32N2O6S and a molecular weight of 632.74 g/mol. Its IUPAC name is 4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]aniline;N-[4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]phenyl]-1-phenylmethanesulfonamide.
| Compound Name | 4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]aniline;N-[4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]phenyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 160797681 |
| Molecular Formula | C37H32N2O6S |
| Molecular Weight | 632.74 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | 4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]aniline;N-[4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]phenyl]-1-phenylmethanesulfonamide |
| SMILES | Nc1ccc(/C=C/c2ccc3c(c2)OCO3)cc1.O=S(=O)(Cc1ccccc1)Nc1ccc(/C=C/c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H19NO4S.C15H13NO2/c24-28(25,15-19-4-2-1-3-5-19)23-20-11-8-17(9-12-20)6-7-18-10-13-21-22(14-18)27-16-26-21;16-13-6-3-11(4-7-13)1-2-12-5-8-14-15(9-12)18-10-17-14/h1-14,23H,15-16H2;1-9H,10,16H2/b7-6+;2-1+ |
| InChIKey | SCQPTFSVYADUPK-XWHJEWPLSA-N |
| XLogP | 7.70 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.74 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|