C9H13Cl4NO7 — CID 160888062
(2S)-2-aminopentanedioic acid;2-oxopropanoic acid;tetrachloromethane (PubChem CID 160888062) has the molecular formula C9H13Cl4NO7 and a molecular weight of 389.02 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;2-oxopropanoic acid;tetrachloromethane.
| Compound Name | (2S)-2-aminopentanedioic acid;2-oxopropanoic acid;tetrachloromethane |
|---|---|
| PubChem CID | 160888062 |
| Molecular Formula | C9H13Cl4NO7 |
| Molecular Weight | 389.02 g/mol |
| Exact Mass | 386.94 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;2-oxopropanoic acid;tetrachloromethane |
| SMILES | CC(=O)C(=O)O.ClC(Cl)(Cl)Cl.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.C3H4O3.CCl4/c6-3(5(9)10)1-2-4(7)8;1-2(4)3(5)6;2-1(3,4)5/h3H,1-2,6H2,(H,7,8)(H,9,10);1H3,(H,5,6);/t3-;;/m0../s1 |
| InChIKey | SNXBLWCWPNNZIP-QTNFYWBSSA-N |
| XLogP | 1.48 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.02 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|