C39H51N2O3S+ — CID 161302099
2-[5-(1-hexyl-3,3,5-trimethylindol-1-ium-2-yl)pentylidene]-3,3-dimethyl-1-(3-methylphenyl)indole-5-sulfonic acid (PubChem CID 161302099) has the molecular formula C39H51N2O3S+ and a molecular weight of 627.92 g/mol. Its IUPAC name is 2-[5-(1-hexyl-3,3,5-trimethylindol-1-ium-2-yl)pentylidene]-3,3-dimethyl-1-(3-methylphenyl)indole-5-sulfonic acid.
| Compound Name | 2-[5-(1-hexyl-3,3,5-trimethylindol-1-ium-2-yl)pentylidene]-3,3-dimethyl-1-(3-methylphenyl)indole-5-sulfonic acid |
|---|---|
| PubChem CID | 161302099 |
| Molecular Formula | C39H51N2O3S+ |
| Molecular Weight | 627.92 g/mol |
| Exact Mass | 627.36 |
| IUPAC Name | 2-[5-(1-hexyl-3,3,5-trimethylindol-1-ium-2-yl)pentylidene]-3,3-dimethyl-1-(3-methylphenyl)indole-5-sulfonic acid |
| SMILES | CCCCCC[N+]1=C(CCCCC=C2N(c3cccc(C)c3)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C39H50N2O3S/c1-8-9-10-14-24-40-34-22-20-29(3)26-32(34)38(4,5)36(40)18-12-11-13-19-37-39(6,7)33-27-31(45(42,43)44)21-23-35(33)41(37)30-17-15-16-28(2)25-30/h15-17,19-23,25-27H,8-14,18,24H2,1-7H3/p+1 |
| InChIKey | DGWVBFHCYZDXQX-UHFFFAOYSA-O |
| XLogP | 10.08 |
| TPSA | 60.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.92 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|