About 1-benzofuran;1-benzothiophene;2H-isoindole
1-benzofuran;1-benzothiophene;2H-isoindole (PubChem CID 161318272) has the molecular formula C24H19NOS
and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-benzofuran;1-benzothiophene;2H-isoindole.
Molecular Properties
| Compound Name | 1-benzofuran;1-benzothiophene;2H-isoindole |
| PubChem CID | 161318272 |
| Molecular Formula | C24H19NOS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 1-benzofuran;1-benzothiophene;2H-isoindole |
| SMILES | c1ccc2c[nH]cc2c1.c1ccc2occc2c1.c1ccc2sccc2c1 |
| InChI | InChI=1S/C8H7N.C8H6O.C8H6S/c1-2-4-8-6-9-5-7(8)3-1;2*1-2-4-8-7(3-1)5-6-9-8/h1-6,9H;2*1-6H |
| InChIKey | VJUFSRBHFOGFNY-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzofuran;1-benzothiophene;2H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;1-benzothiophene;2H-isoindole?
The IUPAC name of 1-benzofuran;1-benzothiophene;2H-isoindole (CID 161318272) is 1-benzofuran;1-benzothiophene;2H-isoindole.
What is the SMILES notation for 1-benzofuran;1-benzothiophene;2H-isoindole?
The canonical SMILES for 1-benzofuran;1-benzothiophene;2H-isoindole is c1ccc2c[nH]cc2c1.c1ccc2occc2c1.c1ccc2sccc2c1.
What is the InChIKey of 1-benzofuran;1-benzothiophene;2H-isoindole?
The InChIKey is VJUFSRBHFOGFNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C8H6O.C8H6S/c1-2-4-8-6-9-5-7(8)3-1;2*1-2-4-8-7(3-1)5-6-9-8/h1-6,9H;2*1-6H.
What are the key properties of 1-benzofuran;1-benzothiophene;2H-isoindole?
1-benzofuran;1-benzothiophene;2H-isoindole has a molecular weight of 369.49 g/mol, XLogP of 7.50, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;1-benzothiophene;2H-isoindole is sourced from PubChem (CID 161318272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).