C23H21F17O7 — CID 161378504
[2-[[1,1,1,5,5,5-hexafluoro-3-(2,2,2-trifluoroethyl)pent-2-en-2-yl]oxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;bis(tetrafluoromethane) (PubChem CID 161378504) has the molecular formula C23H21F17O7 and a molecular weight of 732.38 g/mol. Its IUPAC name is [2-[[1,1,1,5,5,5-hexafluoro-3-(2,2,2-trifluoroethyl)pent-2-en-2-yl]oxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;bis(tetrafluoromethane).
| Compound Name | [2-[[1,1,1,5,5,5-hexafluoro-3-(2,2,2-trifluoroethyl)pent-2-en-2-yl]oxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;bis(tetrafluoromethane) |
|---|---|
| PubChem CID | 161378504 |
| Molecular Formula | C23H21F17O7 |
| Molecular Weight | 732.38 g/mol |
| Exact Mass | 732.10 |
| IUPAC Name | [2-[[1,1,1,5,5,5-hexafluoro-3-(2,2,2-trifluoroethyl)pent-2-en-2-yl]oxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate;bis(tetrafluoromethane) |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=C(CC(F)(F)F)CC(F)(F)F)C(F)(F)F.FC(F)(F)F.FC(F)(F)F |
| InChI | InChI=1S/C21H21F9O7.2CF4/c1-4-14(31)34-9-18(10-35-15(32)5-2,11-36-16(33)6-3)12-37-17(21(28,29)30)13(7-19(22,23)24)8-20(25,26)27;2*2-1(3,4)5/h4-6H,1-3,7-12H2;; |
| InChIKey | VRJYXKBDQOOALU-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.38 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|