C18H23- — CID 161461012
1,6-dimethyl-5-methylidenecyclohexa-1,3-diene;1,2,3-trimethylbenzene (PubChem CID 161461012) has the molecular formula C18H23- and a molecular weight of 239.38 g/mol. Its IUPAC name is 1,6-dimethyl-5-methylidenecyclohexa-1,3-diene;1,2,3-trimethylbenzene.
| Compound Name | 1,6-dimethyl-5-methylidenecyclohexa-1,3-diene;1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 161461012 |
| Molecular Formula | C18H23- |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | 1,6-dimethyl-5-methylidenecyclohexa-1,3-diene;1,2,3-trimethylbenzene |
| SMILES | C=C1C=CC=C(C)[C-]1C.Cc1cccc(C)c1C |
| InChI | InChI=1S/C9H12.C9H11/c2*1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3;4-6H,1H2,2-3H3/q;-1 |
| InChIKey | WBUQUSYNOIVNLW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|