C11H8N4O4 — CID 162017674
6-[(2-oxo-3H-1-benzofuran-6-yl)amino]-1H-1,3,5-triazine-2,4-dione (PubChem CID 162017674) has the molecular formula C11H8N4O4 and a molecular weight of 260.21 g/mol. Its IUPAC name is 6-[(2-oxo-3H-1-benzofuran-6-yl)amino]-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 6-[(2-oxo-3H-1-benzofuran-6-yl)amino]-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 162017674 |
| Molecular Formula | C11H8N4O4 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 6-[(2-oxo-3H-1-benzofuran-6-yl)amino]-1H-1,3,5-triazine-2,4-dione |
| SMILES | O=C1Cc2ccc(Nc3nc(=O)[nH]c(=O)[nH]3)cc2O1 |
| InChI | InChI=1S/C11H8N4O4/c16-8-3-5-1-2-6(4-7(5)19-8)12-9-13-10(17)15-11(18)14-9/h1-2,4H,3H2,(H3,12,13,14,15,17,18) |
| InChIKey | WHAPQOQNDDSWSY-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|