C26H19F3O2S — CID 162253416
diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate (PubChem CID 162253416) has the molecular formula C26H19F3O2S and a molecular weight of 452.50 g/mol. Its IUPAC name is diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate.
| Compound Name | diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate |
|---|---|
| PubChem CID | 162253416 |
| Molecular Formula | C26H19F3O2S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate |
| SMILES | CC(=O)[O-].Fc1cc([S+](c2ccccc2)c2ccccc2)c(F)c(F)c1-c1ccccc1 |
| InChI | InChI=1S/C24H16F3S.C2H4O2/c25-20-16-21(23(26)24(27)22(20)17-10-4-1-5-11-17)28(18-12-6-2-7-13-18)19-14-8-3-9-15-19;1-2(3)4/h1-16H;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | PMIGWLWCGSXNHA-UHFFFAOYSA-M |
| XLogP | 5.62 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|