About diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate
diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate (PubChem CID 162253416) has the molecular formula C26H19F3O2S
and a molecular weight of 452.50 g/mol. Its IUPAC name is diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate.
Molecular Properties
| Compound Name | diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate |
| PubChem CID | 162253416 |
| Molecular Formula | C26H19F3O2S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate |
| SMILES | CC(=O)[O-].Fc1cc([S+](c2ccccc2)c2ccccc2)c(F)c(F)c1-c1ccccc1 |
| InChI | InChI=1S/C24H16F3S.C2H4O2/c25-20-16-21(23(26)24(27)22(20)17-10-4-1-5-11-17)28(18-12-6-2-7-13-18)19-14-8-3-9-15-19;1-2(3)4/h1-16H;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | PMIGWLWCGSXNHA-UHFFFAOYSA-M |
| XLogP | 5.62 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate?
The IUPAC name of diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate (CID 162253416) is diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate.
What is the SMILES notation for diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate?
The canonical SMILES for diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate is CC(=O)[O-].Fc1cc([S+](c2ccccc2)c2ccccc2)c(F)c(F)c1-c1ccccc1.
What is the InChIKey of diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate?
The InChIKey is PMIGWLWCGSXNHA-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H16F3S.C2H4O2/c25-20-16-21(23(26)24(27)22(20)17-10-4-1-5-11-17)28(18-12-6-2-7-13-18)19-14-8-3-9-15-19;1-2(3)4/h1-16H;1H3,(H,3,4)/q+1;/p-1.
What are the key properties of diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate?
diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate has a molecular weight of 452.50 g/mol, XLogP of 5.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-(2,3,5-trifluoro-4-phenylphenyl)sulfanium acetate is sourced from PubChem (CID 162253416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).