C20H28BNO3 — CID 162470520
(2R)-2-(2,3-dihydro-1-benzofuran-3-yl)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine (PubChem CID 162470520) has the molecular formula C20H28BNO3 and a molecular weight of 341.26 g/mol. Its IUPAC name is (2R)-2-(2,3-dihydro-1-benzofuran-3-yl)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine.
| Compound Name | (2R)-2-(2,3-dihydro-1-benzofuran-3-yl)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
|---|---|
| PubChem CID | 162470520 |
| Molecular Formula | C20H28BNO3 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (2R)-2-(2,3-dihydro-1-benzofuran-3-yl)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@@H](CN)C4COc5ccccc54)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C20H28BNO3/c1-19(2)12-8-17(19)20(3)18(9-12)24-21(25-20)15(10-22)14-11-23-16-7-5-4-6-13(14)16/h4-7,12,14-15,17-18H,8-11,22H2,1-3H3/t12-,14?,15-,17-,18+,20-/m0/s1 |
| InChIKey | YPMOBMSBXKYQIX-MNDRPMHISA-N |
| XLogP | 3.22 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|