C33H20BrN3 — CID 162496965
2-(3-bromotriphenylen-2-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazine (PubChem CID 162496965) has the molecular formula C33H20BrN3 and a molecular weight of 543.48 g/mol. Its IUPAC name is 2-(3-bromotriphenylen-2-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(3-bromotriphenylen-2-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 162496965 |
| Molecular Formula | C33H20BrN3 |
| Molecular Weight | 543.48 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 2-(3-bromotriphenylen-2-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3)nc(-c3cc4c5ccccc5c5ccccc5c4cc3Br)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C33H20BrN3/c34-30-20-28-26-18-10-8-16-24(26)23-15-7-9-17-25(23)27(28)19-29(30)33-36-31(21-11-3-1-4-12-21)35-32(37-33)22-13-5-2-6-14-22/h1-20H/i1D,3D,4D,11D,12D |
| InChIKey | VHAZXHFVUALKCZ-KTRFVSTQSA-N |
| XLogP | 9.09 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.48 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|